CAS 917248-51-2 appears in our catalog under these names: 5,7-difluoro-3,4-dihydro-2H-1-benzopyran-4-ol, 95%, 95%, 5,7-Difluorochroman-4-ol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
5,7-difluoro-3,4-dihydro-2H-chromen-4-ol (CAS 917248-51-2) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 5,7-difluoro-3,4-dihydro-2H-chromen-4-ol. InChIKey: HGTYMLFMXKYIQW-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 5,7-difluoro-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | HGTYMLFMXKYIQW-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1O)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)