Products 942195-91-7
CAS 942195-91-7 appears in our catalog under these names: Tegoprazan Impurity 12, (S)-5,7-Difluorochroman-4-ol 98%, (S)-5,7-Difluorochroman-4-ol, 98%, 98%, (S)-5,7-Difluorochroman-4-ol, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 500mg, 10g, 25g.
(4S)-5,7-difluoro-3,4-dihydro-2H-chromen-4-ol (CAS 942195-91-7) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: (4S)-5,7-difluoro-3,4-dihydro-2H-chromen-4-ol. InChIKey: HGTYMLFMXKYIQW-ZETCQYMHSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | (4S)-5,7-difluoro-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | HGTYMLFMXKYIQW-ZETCQYMHSA-N |
| SMILES | C1COC2=C([C@H]1O)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)