CAS 1270294-05-7 appears in our catalog under these names: Tegoprazan Impurity 11, (4R)-5,7-Difluoro-3,4-dihydro-2H-1-benzopyran-4-ol, (R)-5,7-Difluorochroman-4-ol 97%, 2H-1-Benzopyran-4-ol, 5,7-difluoro-3,4-dihydro-, (4R)-, 97%, 97%, (R)-5,7-Difluorochroman-4-ol, 99.98%. Offered by: Chemat Brand, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: on request, 5g, 100mg, 250mg, 1g, 25g, 500mg, 10g.
(4R)-5,7-difluoro-3,4-dihydro-2H-chromen-4-ol (CAS 1270294-05-7) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: (4R)-5,7-difluoro-3,4-dihydro-2H-chromen-4-ol. InChIKey: HGTYMLFMXKYIQW-SSDOTTSWSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | (4R)-5,7-difluoro-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | HGTYMLFMXKYIQW-SSDOTTSWSA-N |
| SMILES | C1COC2=C([C@@H]1O)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)