cas: 132696-45-8 — see every product listed under this CAS number, including other names
(R)-Boc-β2-Abu-OH 97% (CAS 132696-45-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A241182-100mg |
| cas | 132696-45-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 687.44 Pln | |
| Ambeed | 5g | 3123.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A241182 |
(2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 132696-45-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: GDQRNRYMFXDGMS-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | GDQRNRYMFXDGMS-ZCFIWIBFSA-N |
| SMILES | C[C@H](CNC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)