cas: 845908-98-7 — see every product listed under this CAS number, including other names
(R)-METHYL 3-AMINO-3-(4-BROMOPHENYL)PROPANOATE HCL, 95% (CAS 845908-98-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F538075-100MG |
| cas | 845908-98-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 763.29 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (3R)-3-amino-3-(4-bromophenyl)propanoate;hydrochloride (CAS 845908-98-7) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: methyl (3R)-3-amino-3-(4-bromophenyl)propanoate;hydrochloride. InChIKey: KCAPQHNPIIVGSF-SBSPUUFOSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | methyl (3R)-3-amino-3-(4-bromophenyl)propanoate;hydrochloride |
| InChIKey | KCAPQHNPIIVGSF-SBSPUUFOSA-N |
| SMILES | COC(=O)C[C@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)