CAS 1632296-25-3 appears in our catalog under these names: (R)-3-Amino-4-(3-bromophenyl)butanoic acid hydrochloride, 95%, (R)-3-Amino-4-(3-bromophenyl)butanoic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 50mg, 100mg.
(3R)-3-amino-4-(3-bromophenyl)butanoic acid;hydrochloride (CAS 1632296-25-3) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: (3R)-3-amino-4-(3-bromophenyl)butanoic acid;hydrochloride. InChIKey: OWNVEWYNSXDFOL-SBSPUUFOSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | (3R)-3-amino-4-(3-bromophenyl)butanoic acid;hydrochloride |
| InChIKey | OWNVEWYNSXDFOL-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)