cas: 172823-13-1 — see every product listed under this CAS number, including other names
(R)-Methyl 3-amino-4-methylpentanoate hydrochloride, 97%, 97% (CAS 172823-13-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZL9-100mg |
| cas | 172823-13-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 1144.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (3R)-3-amino-4-methylpentanoate;hydrochloride (CAS 172823-13-1) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl (3R)-3-amino-4-methylpentanoate;hydrochloride. InChIKey: PPXNDBYZDBBPCL-FYZOBXCZSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | methyl (3R)-3-amino-4-methylpentanoate;hydrochloride |
| InChIKey | PPXNDBYZDBBPCL-FYZOBXCZSA-N |
| SMILES | CC(C)[C@@H](CC(=O)OC)N.Cl |
Computed by PubChem (NCBI)