cas: 172823-13-1 — see every product listed under this CAS number, including other names
Methyl (R)-homo-beta-valinate hydrochloride, 97% (CAS 172823-13-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050734-100MG |
| cas | 172823-13-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 1g | 3043.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (3R)-3-amino-4-methylpentanoate;hydrochloride (CAS 172823-13-1) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl (3R)-3-amino-4-methylpentanoate;hydrochloride. InChIKey: PPXNDBYZDBBPCL-FYZOBXCZSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | methyl (3R)-3-amino-4-methylpentanoate;hydrochloride |
| InChIKey | PPXNDBYZDBBPCL-FYZOBXCZSA-N |
| SMILES | CC(C)[C@@H](CC(=O)OC)N.Cl |
Computed by PubChem (NCBI)