cas: 1097196-96-7 — see every product listed under this CAS number, including other names
(R)-Methyl 4-(1-aminoethyl)benzoate hydrochloride, 95%, 95% (CAS 1097196-96-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103BM-100mg |
| cas | 1097196-96-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 371.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride (CAS 1097196-96-7) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride. InChIKey: XOTRLVYRAWIVLC-OGFXRTJISA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride |
| InChIKey | XOTRLVYRAWIVLC-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)