cas: 1438415-89-4 — see every product listed under this CAS number, including other names
(R,E)-Cyclooct-4-en-1-yl (4-nitrophenyl) carbonate, 98% (CAS 1438415-89-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F982222-50MG |
| cas | 1438415-89-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1528.65 Pln | |
| Fluorochem | 100mg | 2559.53 Pln | |
| Fluorochem | 250mg | 4308.92 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[(4Z)-cyclooct-4-en-1-yl] (4-nitrophenyl) carbonate (CAS 1438415-89-4) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: [(4Z)-cyclooct-4-en-1-yl] (4-nitrophenyl) carbonate. InChIKey: FJMMADPCDJNXAH-UPHRSURJSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | [(4Z)-cyclooct-4-en-1-yl] (4-nitrophenyl) carbonate |
| InChIKey | FJMMADPCDJNXAH-UPHRSURJSA-N |
| SMILES | C1C/C=C\CCC(C1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)