cas: 1438415-89-4 — see every product listed under this CAS number, including other names
TCO-PNB ester 98% + rel-(1R-4E-pR)-equatorial (CAS 1438415-89-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1513369-50mg |
| cas | 1438415-89-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 687.44 Pln | |
| Ambeed | 100mg | 1121.31 Pln | |
| Ambeed | 250mg | 1861.13 Pln | |
| Ambeed | 1g | 6389.00 Pln |
| purity | 98% + rel-(1R-4E-pR)-equatorial |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1513369 |
[(4Z)-cyclooct-4-en-1-yl] (4-nitrophenyl) carbonate (CAS 1438415-89-4) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: [(4Z)-cyclooct-4-en-1-yl] (4-nitrophenyl) carbonate. InChIKey: FJMMADPCDJNXAH-UPHRSURJSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | [(4Z)-cyclooct-4-en-1-yl] (4-nitrophenyl) carbonate |
| InChIKey | FJMMADPCDJNXAH-UPHRSURJSA-N |
| SMILES | C1C/C=C\CCC(C1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)