cas: 15028-39-4 — see every product listed under this CAS number, including other names
(S)-(+)-2-Phenylglycine methyl ester hydrochloride, 97% (CAS 15028-39-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 442190100 |
| cas | 15028-39-4 |
| size | 10g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 130.96 Pln | |
| Thermo Scientific (Acros) | 50g | 422.28 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
Methyl (2S)-2-amino-2-phenylacetate;hydrochloride (CAS 15028-39-4) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl (2S)-2-amino-2-phenylacetate;hydrochloride. InChIKey: DTHMTBUWTGVEFG-QRPNPIFTSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-phenylacetate;hydrochloride |
| InChIKey | DTHMTBUWTGVEFG-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)