cas: 15028-39-4 — see every product listed under this CAS number, including other names
H-Phg-OMe·HCl 98% (CAS 15028-39-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A185347-25g |
| cas | 15028-39-4 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 220.19 Pln | |
| Ambeed | 500g | 448.25 Pln | |
| Ambeed | 1000g | 820.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A185347 |
Methyl (2S)-2-amino-2-phenylacetate;hydrochloride (CAS 15028-39-4) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl (2S)-2-amino-2-phenylacetate;hydrochloride. InChIKey: DTHMTBUWTGVEFG-QRPNPIFTSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-phenylacetate;hydrochloride |
| InChIKey | DTHMTBUWTGVEFG-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)