cas: 451503-28-9 — see every product listed under this CAS number, including other names
(S)-(4-Chlorophenyl)(phenyl)methanaminehydrochloride, 98% (CAS 451503-28-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049240-100MG |
| cas | 451503-28-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 1028.82 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(S)-(4-chlorophenyl)-phenylmethanamine;hydrochloride (CAS 451503-28-9) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: (S)-(4-chlorophenyl)-phenylmethanamine;hydrochloride. InChIKey: UHPRBUXOILBKFH-ZOWNYOTGSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | (S)-(4-chlorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | UHPRBUXOILBKFH-ZOWNYOTGSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C2=CC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)