cas: 132873-57-5 — see every product listed under this CAS number, including other names
(S)-1-(4-Nitrophenyl)ethanamine hydrochloride 98% (CAS 132873-57-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129282-250mg |
| cas | 132873-57-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 887.69 Pln | |
| Ambeed | 500g | 4130.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A129282 |
(1S)-1-(4-nitrophenyl)ethanamine;hydrochloride (CAS 132873-57-5) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: (1S)-1-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: CZQQGVFHLSBEDV-RGMNGODLSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (1S)-1-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | CZQQGVFHLSBEDV-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)