cas: 132873-57-5 — see every product listed under this CAS number, including other names
1-(S)-4-Nitrophenyl ethylamine hydrochloride, 95% (CAS 132873-57-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046529-10G |
| cas | 132873-57-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 206.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(1S)-1-(4-nitrophenyl)ethanamine;hydrochloride (CAS 132873-57-5) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: (1S)-1-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: CZQQGVFHLSBEDV-RGMNGODLSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (1S)-1-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | CZQQGVFHLSBEDV-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)