cas: 132873-57-5 — see every product listed under this CAS number, including other names
(S)-1-(4-Nitrophenyl)ethanamine hydrochloride, 95%, 95% (CAS 132873-57-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1122B7-1g |
| cas | 132873-57-5 |
| size | 1g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 246.80 Pln | |
| Chemat | 100g | 789.20 Pln | |
| Chemat | 500g | 3748.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-(4-nitrophenyl)ethanamine;hydrochloride (CAS 132873-57-5) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: (1S)-1-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: CZQQGVFHLSBEDV-RGMNGODLSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (1S)-1-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | CZQQGVFHLSBEDV-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)