CAS 57233-86-0 appears in our catalog under these names: (R)–1–(4–Nitrophenyl)ethanamine hydrochloride, (R)-α-Methyl-4-nitrobenzylamine HCl 97%, (R)-1-(4-Nitrophenyl)ethanamine hydrochloride, 97%, 97%, (R)-alpha-Methyl-4-nitrobenzylamine hydrochloride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 10g.
(1R)-1-(4-nitrophenyl)ethanamine;hydrochloride (CAS 57233-86-0) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: (1R)-1-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: CZQQGVFHLSBEDV-FYZOBXCZSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (1R)-1-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | CZQQGVFHLSBEDV-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)