CAS 92203-66-2 is the registry number for 1-(4-Nitrophenyl)ethanamine hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
1-(4-nitrophenyl)ethanamine;hydrochloride (CAS 92203-66-2) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 1-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: CZQQGVFHLSBEDV-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 1-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | CZQQGVFHLSBEDV-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)