cas: 70918-54-6 — see every product listed under this CAS number, including other names
(S)-2,3-Dihydro-benzo[1,4]dioxine-2-carboxylic acid, 98% (CAS 70918-54-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049581-250MG |
| cas | 70918-54-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1632.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (CAS 70918-54-6) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid. InChIKey: HMBHAQMOBKLWRX-QMMMGPOBSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| InChIKey | HMBHAQMOBKLWRX-QMMMGPOBSA-N |
| SMILES | C1[C@H](OC2=CC=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)