Products 34385-93-8

CAS 34385-93-8 is the registry number for 1,4-Benzodioxane-2-carboxylic acid, 98%,RG, 98%,RG. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (CAS 34385-93-8) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-3-carboxylic acid. InChIKey: HMBHAQMOBKLWRX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8O4
Molecular weight180.16 g/mol
IUPAC name2,3-dihydro-1,4-benzodioxine-3-carboxylic acid
InChIKeyHMBHAQMOBKLWRX-UHFFFAOYSA-N
SMILESC1C(OC2=CC=CC=C2O1)C(=O)O

Computed by PubChem (NCBI)