CAS 34385-93-8 is the registry number for 1,4-Benzodioxane-2-carboxylic acid, 98%,RG, 98%,RG. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g, 1g.
2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (CAS 34385-93-8) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-3-carboxylic acid. InChIKey: HMBHAQMOBKLWRX-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| InChIKey | HMBHAQMOBKLWRX-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)