CAS 3663-80-7 appears in our catalog under these names: Doxazosin Impurity 3, rac 1,4-Benzodioxane-2-carboxylic Acid, >95% (HPLC), (2RS)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic Acid, 2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid, 97% , 1,4-Benzodioxane-2-carboxylic Acid, >98.0%(GC)(T). Offered by: Chemat Brand, TRC, Mikromol, Thermo Scientific, TCI. Available pack sizes: on request, 1g, 4x25mg, 25mg, 100mg, 250MG, 5g, 25g.
2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (CAS 3663-80-7) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-3-carboxylic acid. InChIKey: HMBHAQMOBKLWRX-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| InChIKey | HMBHAQMOBKLWRX-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)