cas: 105382-09-0 — see every product listed under this CAS number, including other names
(S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS 105382-09-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235525-1G |
| cas | 105382-09-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 25g | 1346.42 Pln |
| delivery time | 3-4 weeks |
|---|
(2S)-2-amino-4-phenylbutanoic acid;hydrochloride (CAS 105382-09-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (2S)-2-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: CHBMONIBOQCTCF-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (2S)-2-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | CHBMONIBOQCTCF-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)