cas: 105382-09-0 — see every product listed under this CAS number, including other names
L-Homophenylalanine, HCl, 98%, 98% (CAS 105382-09-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WN9-1g |
| cas | 105382-09-0 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 246.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-4-phenylbutanoic acid;hydrochloride (CAS 105382-09-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (2S)-2-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: CHBMONIBOQCTCF-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (2S)-2-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | CHBMONIBOQCTCF-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)