(S)-4-Methyl-2-(5-(trifluoromethyl)pyridin-2-yl)-4,5-dihydrooxazole, 98%
cas: 1803416-27-4 — see every product listed under this CAS number, including other names
(S)-4-Methyl-2-(5-(trifluoromethyl)pyridin-2-yl)-4,5-dihydrooxazole, 98% (CAS 1803416-27-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1263095-250mg |
| cas | 1803416-27-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 1110.19 Pln | |
| BLDpharm | 100mg | 308.80 Pln | |
| BLDpharm | 250mg | 358.79 Pln | |
| BLDpharm | 1g | 1191.83 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 822.80 Pln | |
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 1143.37 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-4-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole (CAS 1803416-27-4) is a chemical compound with the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. IUPAC name: (4S)-4-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole. InChIKey: UITFYNBEZIIWCV-LURJTMIESA-N.
| Molecular formula | C10H9F3N2O |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | (4S)-4-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
| InChIKey | UITFYNBEZIIWCV-LURJTMIESA-N |
| SMILES | C[C@H]1COC(=N1)C2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
(S)-4-Methyl-2-(5-(trifluoromethyl)pyridin-2-yl)-4,5-dihydrooxazole, Pyridine, 2-[(4S)-4,5-dihydro-4-methyl-2-oxazolyl]-5-(trifluoromethyl)-, (S)-4-Methyl-2-[5-(trifluoromethyl)-2-pyridyl]-4,5-dihydrooxazole, (4S)-4-methyl-2-[5-(trifluoromethyl)-2-pyridyl]-4,5-dihydrooxazole, (4S)-4-methyl-2-[5-(trifluoromethyl)pyridin-2-yl]-4,5-dihydro-1,3-oxazole, (S)-4-Methyl-2-(5-(trifluoromethyl)pyridin-2-yl)-4,5-dihydrooxazole - [M92017]