CAS 173669-34-6 is the registry number for 1–(6–Aminoindolin–1–yl)–2,2,2–trifluoroethan–1–one. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
1-(6-amino-2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone (CAS 173669-34-6) is a chemical compound with the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. IUPAC name: 1-(6-amino-2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone. InChIKey: MSWPTDJKPPNYPR-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 1-(6-amino-2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone |
| InChIKey | MSWPTDJKPPNYPR-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=CC(=C2)N)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)