CAS 790677-27-9 appears in our catalog under these names: 1-(5-Aminoindolin-1-yl)-2,2,2-trifluoroethanone, 95%, 1-(5-Aminoindolin-1-yl)-2,2,2-trifluoroethanone, 95+%, 1–(5–Aminoindolin–1–yl)–2,2,2–trifluoroethanone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(5-amino-2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone (CAS 790677-27-9) is a chemical compound with the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. IUPAC name: 1-(5-amino-2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone. InChIKey: VIVZNUFDVKYJRB-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 1-(5-amino-2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone |
| InChIKey | VIVZNUFDVKYJRB-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=C(C=C2)N)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)