CAS 1368864-43-0 is the registry number for 1-(4-Amino-2,3-dihydro-1H-indol-1-yl)-2,2,2-trifluoroethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(4-amino-2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone (CAS 1368864-43-0) is a chemical compound with the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. IUPAC name: 1-(4-amino-2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone. InChIKey: SHXHOHZNGNFXPF-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 1-(4-amino-2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone |
| InChIKey | SHXHOHZNGNFXPF-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC(=C21)N)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)