CAS 1306738-19-1 is the registry number for 3-Amino-1-methyl-7-(trifluoromethyl)-1,3-dihydro-2h-indol-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-amino-1-methyl-7-(trifluoromethyl)-3H-indol-2-one (CAS 1306738-19-1) is a chemical compound with the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. IUPAC name: 3-amino-1-methyl-7-(trifluoromethyl)-3H-indol-2-one. InChIKey: WOIOSHZXTSVCLO-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 3-amino-1-methyl-7-(trifluoromethyl)-3H-indol-2-one |
| InChIKey | WOIOSHZXTSVCLO-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(C2=C1C(=CC=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)