CAS 1309602-02-5 is the registry number for 3-(2,2,2-Trifluoroethyl)-1,2,3,4-tetrahydroquinoxalin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-quinoxalin-2-one (CAS 1309602-02-5) is a chemical compound with the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. IUPAC name: 3-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-quinoxalin-2-one. InChIKey: QKWAESOVSXOSPL-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-quinoxalin-2-one |
| InChIKey | QKWAESOVSXOSPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(C(=O)N2)CC(F)(F)F |
Computed by PubChem (NCBI)