CAS 37040-48-5 is the registry number for 8-(Trifluoromethyl)-1,3,4,5-tetrahydro-2h-1,5-benzodiazepin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
7-(trifluoromethyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (CAS 37040-48-5) is a chemical compound with the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. IUPAC name: 7-(trifluoromethyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one. InChIKey: IQXBTFYYERUXCM-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 7-(trifluoromethyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| InChIKey | IQXBTFYYERUXCM-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=C(C=C2)C(F)(F)F)NC1=O |
Computed by PubChem (NCBI)