CAS 1882759-90-1 appears in our catalog under these names: 2-Methyl-6-((1,1,1-trifluoropropan-2-yl)oxy)pyridine-3-carbonitrile, 95%, 2-Methyl-6-((1,1,1-trifluoropropan-2-yl)oxy)pyridine-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carbonitrile (CAS 1882759-90-1) is a chemical compound with the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. IUPAC name: 2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carbonitrile. InChIKey: DMSGTMOZYRJARD-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carbonitrile |
| InChIKey | DMSGTMOZYRJARD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)OC(C)C(F)(F)F)C#N |
Computed by PubChem (NCBI)