CAS 697305-97-8 is the registry number for 1-(5-Aminoisoindolin-2-yl)-2,2,2-trifluoroethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-amino-1,3-dihydroisoindol-2-yl)-2,2,2-trifluoroethanone (CAS 697305-97-8) is a chemical compound with the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. IUPAC name: 1-(5-amino-1,3-dihydroisoindol-2-yl)-2,2,2-trifluoroethanone. InChIKey: GLZWTOBGMDMQCW-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 1-(5-amino-1,3-dihydroisoindol-2-yl)-2,2,2-trifluoroethanone |
| InChIKey | GLZWTOBGMDMQCW-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1C(=O)C(F)(F)F)C=C(C=C2)N |
Computed by PubChem (NCBI)