cas: 2225878-88-4 — see every product listed under this CAS number, including other names
(S)-6-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 95%, 95% (CAS 2225878-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DU92-100mg |
| cas | 2225878-88-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 549.20 Pln | |
| Chemat | 250mg | 741.20 Pln | |
| Chemat | 1g | 1998.80 Pln | |
| Chemat | 5g | 5675.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3S)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2225878-88-4) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: (3S)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: BTTOLFCXRXFGKD-OGFXRTJISA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | (3S)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | BTTOLFCXRXFGKD-OGFXRTJISA-N |
| SMILES | C1[C@H](C2=C(O1)C=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)