cas: 2225878-88-4 — see every product listed under this CAS number, including other names
(S)-6-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 97% (CAS 2225878-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F618616-100MG |
| cas | 2225878-88-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 883.04 Pln | |
| Fluorochem | 250mg | 1320.39 Pln | |
| Fluorochem | 500mg | 2236.73 Pln | |
| Fluorochem | 1g | 3298.86 Pln | |
| Fluorochem | 5g | 9416.49 Pln | |
| Fluorochem | 10g | 17148.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(3S)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2225878-88-4) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: (3S)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: BTTOLFCXRXFGKD-OGFXRTJISA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | (3S)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | BTTOLFCXRXFGKD-OGFXRTJISA-N |
| SMILES | C1[C@H](C2=C(O1)C=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)