cas: 19460-85-6 — see every product listed under this CAS number, including other names
(S)-Methyl 2-(benzylamino)propanoate hydrochloride, 95% (CAS 19460-85-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F323655-1G |
| cas | 19460-85-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 471.73 Pln | |
| Fluorochem | 25g | 476.93 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (2S)-2-(benzylamino)propanoate;hydrochloride (CAS 19460-85-6) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: methyl (2S)-2-(benzylamino)propanoate;hydrochloride. InChIKey: FJUWPAKLUHULRE-FVGYRXGTSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | methyl (2S)-2-(benzylamino)propanoate;hydrochloride |
| InChIKey | FJUWPAKLUHULRE-FVGYRXGTSA-N |
| SMILES | C[C@@H](C(=O)OC)NCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)