cas: 1029696-37-4 — see every product listed under this CAS number, including other names
1(3H)-ISOBENZOFURANONE, 5-BROMO-3,3-DIMETHYL-, 97% (CAS 1029696-37-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F534839-100MG |
| cas | 1029696-37-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 544.62 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 500mg | 1549.47 Pln | |
| Fluorochem | 1g | 2184.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-3,3-dimethyl-2-benzofuran-1-one (CAS 1029696-37-4) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 5-bromo-3,3-dimethyl-2-benzofuran-1-one. InChIKey: JYFGZJHNKDPESK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-bromo-3,3-dimethyl-2-benzofuran-1-one |
| InChIKey | JYFGZJHNKDPESK-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Br)C(=O)O1)C |
Computed by PubChem (NCBI)