cas: 1029696-37-4 — see every product listed under this CAS number, including other names
5-Bromo-3,3-dimethylisobenzofuran-1(3h)-one, 95%, 95% (CAS 1029696-37-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12XA1O-100mg |
| cas | 1029696-37-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 500mg | 1125.20 Pln | |
| Chemat | 1g | 1787.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-3,3-dimethyl-2-benzofuran-1-one (CAS 1029696-37-4) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 5-bromo-3,3-dimethyl-2-benzofuran-1-one. InChIKey: JYFGZJHNKDPESK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-bromo-3,3-dimethyl-2-benzofuran-1-one |
| InChIKey | JYFGZJHNKDPESK-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Br)C(=O)O1)C |
Computed by PubChem (NCBI)