cas: 41994-51-8 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid hydrochloride 98% (CAS 41994-51-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A633648-1g |
| cas | 41994-51-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 348.12 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 25g | 565.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A633648 |
1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride (CAS 41994-51-8) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride. InChIKey: FXHCFPUEIDRTMR-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | FXHCFPUEIDRTMR-UHFFFAOYSA-N |
| SMILES | C1C(NCC2=CC=CC=C21)C(=O)O.Cl |
Computed by PubChem (NCBI)