CAS 2680615-70-5 is the registry number for 1-(2,6-Dimethoxypyridin-3-yl)methanamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 25mg.
(2,6-dimethoxy-3-pyridinyl)methanamine;dihydrochloride (CAS 2680615-70-5) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 241.11 g/mol. IUPAC name: (2,6-dimethoxy-3-pyridinyl)methanamine;dihydrochloride. InChIKey: CECKMJBENBFXKY-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | (2,6-dimethoxy-3-pyridinyl)methanamine;dihydrochloride |
| InChIKey | CECKMJBENBFXKY-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)CN)OC.Cl.Cl |
Computed by PubChem (NCBI)