Products 1173023-45-4
CAS 1173023-45-4 appears in our catalog under these names: Pyridoxamine-(methyl-d3) Dihydrochloride, Pyridoxamine-d3 dihydrochloride, Pyridoxamine-d3 (dihydrochloride), 99.33%, D3-Pyridoxamine dihydrochloride, 100 µg/ml in Acetonitrile, ISO 17034 CRM. Offered by: Chemat Brand, TargetMol, MedChemExpress, HPC Standards, Sigma-Aldrich. Available pack sizes: on request, 1mg, 5mg, 10mg, 500 μg, 1 mg, 1ml.
4-(aminomethyl)-5-(hydroxymethyl)-2-(trideuteriomethyl)pyridin-3-ol;dihydrochloride (CAS 1173023-45-4) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 244.13 g/mol. IUPAC name: 4-(aminomethyl)-5-(hydroxymethyl)-2-(trideuteriomethyl)pyridin-3-ol;dihydrochloride. InChIKey: HNWCOANXZNKMLR-GXXYEPOPSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | 4-(aminomethyl)-5-(hydroxymethyl)-2-(trideuteriomethyl)pyridin-3-ol;dihydrochloride |
| InChIKey | HNWCOANXZNKMLR-GXXYEPOPSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=C(C(=C1O)CN)CO.Cl.Cl |
Computed by PubChem (NCBI)