CAS 25445-15-2 appears in our catalog under these names: 2,5-Dimethoxybenzene-1,4-diamine dihydrochloride 98%, 2,5-Dimethoxybenzene-1,4-diamine dihydrochloride, 98%, 98%, 2,5-DIMETHOXYBENZENE-1,4-DIAMINE DIHYDROCHLORIDE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,5-dimethoxybenzene-1,4-diamine;dihydrochloride (CAS 25445-15-2) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 241.11 g/mol. IUPAC name: 2,5-dimethoxybenzene-1,4-diamine;dihydrochloride. InChIKey: CQXCPRMLAOQWHW-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 2,5-dimethoxybenzene-1,4-diamine;dihydrochloride |
| InChIKey | CQXCPRMLAOQWHW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1N)OC)N.Cl.Cl |
Computed by PubChem (NCBI)