CAS 1640848-93-6 appears in our catalog under these names: (R)-2-Amino-2-(2-methoxypyridin-4-yl)ethanol dihydrochloride, 95%, (R)-2-Amino-2-(2-methoxypyridin-4-yl)ethanol dihydrochloride, 97%, (R)–2–Amino–2–(2–methoxypyridin–4–yl)ethanol dihydrochloride, (R)-2-Amino-2-(2-methoxypyridin-4-yl)ethanol dihydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg.
(2R)-2-amino-2-(2-methoxy-4-pyridinyl)ethanol;dihydrochloride (CAS 1640848-93-6) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 241.11 g/mol. IUPAC name: (2R)-2-amino-2-(2-methoxy-4-pyridinyl)ethanol;dihydrochloride. InChIKey: KZPYABFLAGAYEU-KLXURFKVSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-methoxy-4-pyridinyl)ethanol;dihydrochloride |
| InChIKey | KZPYABFLAGAYEU-KLXURFKVSA-N |
| SMILES | COC1=NC=CC(=C1)[C@H](CO)N.Cl.Cl |
Computed by PubChem (NCBI)