CAS 2259329-89-8 appears in our catalog under these names: Levetiracetam Impurity 32, Levetiracetam Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2S)-1-amino-1-oxobutan-2-yl]-2,4-dichlorobutanamide (CAS 2259329-89-8) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 241.11 g/mol. IUPAC name: N-[(2S)-1-amino-1-oxobutan-2-yl]-2,4-dichlorobutanamide. InChIKey: LJSHBMKVRRIHMV-GDVGLLTNSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | N-[(2S)-1-amino-1-oxobutan-2-yl]-2,4-dichlorobutanamide |
| InChIKey | LJSHBMKVRRIHMV-GDVGLLTNSA-N |
| SMILES | CC[C@@H](C(=O)N)NC(=O)C(CCCl)Cl |
Computed by PubChem (NCBI)