CAS 870153-93-8 is the registry number for (S)-3-((S)-2-Amino-4-chloro-3-oxobutyl)pyrrolidin-2-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-[(2S)-2-amino-4-chloro-3-oxobutyl]pyrrolidin-2-one;hydrochloride (CAS 870153-93-8) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 241.11 g/mol. IUPAC name: (3S)-3-[(2S)-2-amino-4-chloro-3-oxobutyl]pyrrolidin-2-one;hydrochloride. InChIKey: SUCZQTHNYBDZQG-GEMLJDPKSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | (3S)-3-[(2S)-2-amino-4-chloro-3-oxobutyl]pyrrolidin-2-one;hydrochloride |
| InChIKey | SUCZQTHNYBDZQG-GEMLJDPKSA-N |
| SMILES | C1CNC(=O)[C@@H]1C[C@@H](C(=O)CCl)N.Cl |
Computed by PubChem (NCBI)