cas: 73557-63-8 — see every product listed under this CAS number, including other names
1,2-Dibromo-5-methyl-3-nitrobenzene, 98% (CAS 73557-63-8) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628863-500MG |
| cas | 73557-63-8 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 174.96 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 820.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,2-dibromo-5-methyl-3-nitrobenzene (CAS 73557-63-8) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1,2-dibromo-5-methyl-3-nitrobenzene. InChIKey: XTMGEWKAQQAYST-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1,2-dibromo-5-methyl-3-nitrobenzene |
| InChIKey | XTMGEWKAQQAYST-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)