CAS 326595-66-8 appears in our catalog under these names: 4-Bromo-3-nitrobenzyl bromide, 96%, 4-Bromo-3-nitrobenzyl bromide, 1-Bromo-4-(bromomethyl)-2-nitrobenzene, 95%, 95%, 4-Bromo-3-nitrobenzyl bromide, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 250mg, 100g.
1-bromo-4-(bromomethyl)-2-nitrobenzene (CAS 326595-66-8) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1-bromo-4-(bromomethyl)-2-nitrobenzene. InChIKey: PXAIZWVEYHNBLL-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1-bromo-4-(bromomethyl)-2-nitrobenzene |
| InChIKey | PXAIZWVEYHNBLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)