cas: 1416712-68-9 — see every product listed under this CAS number, including other names
1,3-Dichloroisoquinoline-6-carboxylic acid, 95% (CAS 1416712-68-9) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QD-8597-500mg |
| cas | 1416712-68-9 |
| size | 500mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 500mg | price on request | |
| Ambeed | 100mg | 2550.88 Pln | |
| Ambeed | 250mg | 5031.75 Pln | |
| BLDpharm | 100mg | 1702.76 Pln | |
| BLDpharm | 250mg | 2841.25 Pln | |
| BLDpharm | 1g | 7556.25 Pln | |
| Chemat | 100mg | 1130.00 Pln | |
| Chemat | 250mg | 1878.80 Pln | |
| Chemat | 1g | 6856.40 Pln | |
| Fluorochem | 100mg | 2090.95 Pln | |
| Fluorochem | 250mg | 3465.46 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1,3-dichloroisoquinoline-6-carboxylic acid (CAS 1416712-68-9) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 1,3-dichloroisoquinoline-6-carboxylic acid. InChIKey: KTZMHKYHEQOTGW-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 1,3-dichloroisoquinoline-6-carboxylic acid |
| InChIKey | KTZMHKYHEQOTGW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(C=C2C=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)