CAS 19844-27-0 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-1h-pyrrole-2,5-dione, 95%, 1-(3,4-Dichlorophenyl)-1H-pyrrole-2,5-dione, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(3,4-dichlorophenyl)pyrrole-2,5-dione (CAS 19844-27-0) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)pyrrole-2,5-dione. InChIKey: PJBXBDSTURWRBO-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)pyrrole-2,5-dione |
| InChIKey | PJBXBDSTURWRBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=O)C=CC2=O)Cl)Cl |
Computed by PubChem (NCBI)