CAS 902742-81-8 appears in our catalog under these names: 4,8-Dichloroquinoline-2-carboxylic acid, 95%, 4,8-Dichloroquinoline-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 10000mg.
4,8-dichloroquinoline-2-carboxylic acid (CAS 902742-81-8) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 4,8-dichloroquinoline-2-carboxylic acid. InChIKey: UIDAFLPDLOSYSD-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 4,8-dichloroquinoline-2-carboxylic acid |
| InChIKey | UIDAFLPDLOSYSD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(C=C2Cl)C(=O)O |
Computed by PubChem (NCBI)